C24H23N3O8 — CID 1116125
1-N,3-N-bis(2,5-dimethoxyphenyl)-5-nitrobenzene-1,3-dicarboxamide (PubChem CID 1116125) has the molecular formula C24H23N3O8 and a molecular weight of 481.46 g/mol. Its IUPAC name is 1-N,3-N-bis(2,5-dimethoxyphenyl)-5-nitrobenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(2,5-dimethoxyphenyl)-5-nitrobenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 1116125 |
| Molecular Formula | C24H23N3O8 |
| Molecular Weight | 481.46 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 1-N,3-N-bis(2,5-dimethoxyphenyl)-5-nitrobenzene-1,3-dicarboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2cc(C(=O)Nc3cc(OC)ccc3OC)cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C24H23N3O8/c1-32-17-5-7-21(34-3)19(12-17)25-23(28)14-9-15(11-16(10-14)27(30)31)24(29)26-20-13-18(33-2)6-8-22(20)35-4/h5-13H,1-4H3,(H,25,28)(H,26,29) |
| InChIKey | DLLXTBDMGRMHNK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 138.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|