C25H24N4O11S — CID 173063036
N-[2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfonylamino]phenyl]-3,5-dinitrobenzamide (PubChem CID 173063036) has the molecular formula C25H24N4O11S and a molecular weight of 588.55 g/mol. Its IUPAC name is N-[2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfonylamino]phenyl]-3,5-dinitrobenzamide.
| Compound Name | N-[2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfonylamino]phenyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 173063036 |
| Molecular Formula | C25H24N4O11S |
| Molecular Weight | 588.55 g/mol |
| Exact Mass | 588.12 |
| IUPAC Name | N-[2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfonylamino]phenyl]-3,5-dinitrobenzamide |
| SMILES | COc1cc(OC)c(C=CS(=O)(=O)Nc2ccc(OC)c(NC(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)c2)c(OC)c1 |
| InChI | InChI=1S/C25H24N4O11S/c1-37-19-13-23(39-3)20(24(14-19)40-4)7-8-41(35,36)27-16-5-6-22(38-2)21(11-16)26-25(30)15-9-17(28(31)32)12-18(10-15)29(33)34/h5-14,27H,1-4H3,(H,26,30) |
| InChIKey | VRMJAPFISJGLRZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 198.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|