C20H23ClN2O7S — CID 10151889
2-chloro-N-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylamino]phenyl]acetamide (PubChem CID 10151889) has the molecular formula C20H23ClN2O7S and a molecular weight of 470.93 g/mol. Its IUPAC name is 2-chloro-N-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylamino]phenyl]acetamide.
| Compound Name | 2-chloro-N-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 10151889 |
| Molecular Formula | C20H23ClN2O7S |
| Molecular Weight | 470.93 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | 2-chloro-N-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylamino]phenyl]acetamide |
| SMILES | COc1cc(OC)c(/C=C/S(=O)(=O)Nc2ccc(OC)c(NC(=O)CCl)c2)c(OC)c1 |
| InChI | InChI=1S/C20H23ClN2O7S/c1-27-14-10-18(29-3)15(19(11-14)30-4)7-8-31(25,26)23-13-5-6-17(28-2)16(9-13)22-20(24)12-21/h5-11,23H,12H2,1-4H3,(H,22,24)/b8-7+ |
| InChIKey | DMUDYKYSQLKCSX-BQYQJAHWSA-N |
| XLogP | 3.31 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.93 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|