C24H27NO12S — CID 67102488
4-[2-[2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfonylamino]phenoxy]-2-oxoethoxy]-4-oxobutanoic acid (PubChem CID 67102488) has the molecular formula C24H27NO12S and a molecular weight of 553.54 g/mol. Its IUPAC name is 4-[2-[2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfonylamino]phenoxy]-2-oxoethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-[2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfonylamino]phenoxy]-2-oxoethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 67102488 |
| Molecular Formula | C24H27NO12S |
| Molecular Weight | 553.54 g/mol |
| Exact Mass | 553.13 |
| IUPAC Name | 4-[2-[2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfonylamino]phenoxy]-2-oxoethoxy]-4-oxobutanoic acid |
| SMILES | COc1cc(OC)c(C=CS(=O)(=O)Nc2ccc(OC)c(OC(=O)COC(=O)CCC(=O)O)c2)c(OC)c1 |
| InChI | InChI=1S/C24H27NO12S/c1-32-16-12-19(34-3)17(20(13-16)35-4)9-10-38(30,31)25-15-5-6-18(33-2)21(11-15)37-24(29)14-36-23(28)8-7-22(26)27/h5-6,9-13,25H,7-8,14H2,1-4H3,(H,26,27) |
| InChIKey | UGUYPBXLPWBKAG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 172.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.54 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|