C21H24N2O9S — CID 10310996
3-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylamino]anilino]-3-oxopropanoic acid (PubChem CID 10310996) has the molecular formula C21H24N2O9S and a molecular weight of 480.50 g/mol. Its IUPAC name is 3-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylamino]anilino]-3-oxopropanoic acid.
| Compound Name | 3-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylamino]anilino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 10310996 |
| Molecular Formula | C21H24N2O9S |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 3-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylamino]anilino]-3-oxopropanoic acid |
| SMILES | COc1cc(OC)c(/C=C/S(=O)(=O)Nc2ccc(OC)c(NC(=O)CC(=O)O)c2)c(OC)c1 |
| InChI | InChI=1S/C21H24N2O9S/c1-29-14-10-18(31-3)15(19(11-14)32-4)7-8-33(27,28)23-13-5-6-17(30-2)16(9-13)22-20(24)12-21(25)26/h5-11,23H,12H2,1-4H3,(H,22,24)(H,25,26)/b8-7+ |
| InChIKey | PIAIITXSGJTNRN-BQYQJAHWSA-N |
| XLogP | 2.55 |
| TPSA | 149.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|