C21H21F2NO10S — CID 67102910
2,2-difluoro-3-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylamino]phenoxy]-3-oxopropanoic acid (PubChem CID 67102910) has the molecular formula C21H21F2NO10S and a molecular weight of 517.46 g/mol. Its IUPAC name is 2,2-difluoro-3-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylamino]phenoxy]-3-oxopropanoic acid.
| Compound Name | 2,2-difluoro-3-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylamino]phenoxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 67102910 |
| Molecular Formula | C21H21F2NO10S |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | 2,2-difluoro-3-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylamino]phenoxy]-3-oxopropanoic acid |
| SMILES | COc1cc(OC)c(/C=C/S(=O)(=O)Nc2ccc(OC)c(OC(=O)C(F)(F)C(=O)O)c2)c(OC)c1 |
| InChI | InChI=1S/C21H21F2NO10S/c1-30-13-10-16(32-3)14(17(11-13)33-4)7-8-35(28,29)24-12-5-6-15(31-2)18(9-12)34-20(27)21(22,23)19(25)26/h5-11,24H,1-4H3,(H,25,26)/b8-7+ |
| InChIKey | IILKPFZZDLUZIP-BQYQJAHWSA-N |
| XLogP | 2.76 |
| TPSA | 146.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|