C20H20F3NO8S — CID 91601755
[2-methoxy-5-[3-(2,4,6-trimethoxyphenyl)prop-2-enoylamino]phenyl] trifluoromethanesulfonate (PubChem CID 91601755) has the molecular formula C20H20F3NO8S and a molecular weight of 491.44 g/mol. Its IUPAC name is [2-methoxy-5-[3-(2,4,6-trimethoxyphenyl)prop-2-enoylamino]phenyl] trifluoromethanesulfonate.
| Compound Name | [2-methoxy-5-[3-(2,4,6-trimethoxyphenyl)prop-2-enoylamino]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 91601755 |
| Molecular Formula | C20H20F3NO8S |
| Molecular Weight | 491.44 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | [2-methoxy-5-[3-(2,4,6-trimethoxyphenyl)prop-2-enoylamino]phenyl] trifluoromethanesulfonate |
| SMILES | COc1cc(OC)c(C=CC(=O)Nc2ccc(OC)c(OS(=O)(=O)C(F)(F)F)c2)c(OC)c1 |
| InChI | InChI=1S/C20H20F3NO8S/c1-28-13-10-16(30-3)14(17(11-13)31-4)6-8-19(25)24-12-5-7-15(29-2)18(9-12)32-33(26,27)20(21,22)23/h5-11H,1-4H3,(H,24,25) |
| InChIKey | QFRQARLBZYEUPZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|