C20H21F3N2O7S — CID 10345448
(E)-N-[4-methoxy-3-(trifluoromethylsulfonylamino)phenyl]-3-(2,4,6-trimethoxyphenyl)prop-2-enamide (PubChem CID 10345448) has the molecular formula C20H21F3N2O7S and a molecular weight of 490.46 g/mol. Its IUPAC name is (E)-N-[4-methoxy-3-(trifluoromethylsulfonylamino)phenyl]-3-(2,4,6-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-methoxy-3-(trifluoromethylsulfonylamino)phenyl]-3-(2,4,6-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 10345448 |
| Molecular Formula | C20H21F3N2O7S |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | (E)-N-[4-methoxy-3-(trifluoromethylsulfonylamino)phenyl]-3-(2,4,6-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(OC)c(/C=C/C(=O)Nc2ccc(OC)c(NS(=O)(=O)C(F)(F)F)c2)c(OC)c1 |
| InChI | InChI=1S/C20H21F3N2O7S/c1-29-13-10-17(31-3)14(18(11-13)32-4)6-8-19(26)24-12-5-7-16(30-2)15(9-12)25-33(27,28)20(21,22)23/h5-11,25H,1-4H3,(H,24,26)/b8-6+ |
| InChIKey | IIAJNDPTXUPMQB-SOFGYWHQSA-N |
| XLogP | 3.63 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|