C23H24F2N2O8 — CID 68957821
methyl 2,2-difluoro-3-[2-methoxy-5-[3-(2,4,6-trimethoxyphenyl)prop-2-enoylamino]anilino]-3-oxopropanoate (PubChem CID 68957821) has the molecular formula C23H24F2N2O8 and a molecular weight of 494.45 g/mol. Its IUPAC name is methyl 2,2-difluoro-3-[2-methoxy-5-[3-(2,4,6-trimethoxyphenyl)prop-2-enoylamino]anilino]-3-oxopropanoate.
| Compound Name | methyl 2,2-difluoro-3-[2-methoxy-5-[3-(2,4,6-trimethoxyphenyl)prop-2-enoylamino]anilino]-3-oxopropanoate |
|---|---|
| PubChem CID | 68957821 |
| Molecular Formula | C23H24F2N2O8 |
| Molecular Weight | 494.45 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | methyl 2,2-difluoro-3-[2-methoxy-5-[3-(2,4,6-trimethoxyphenyl)prop-2-enoylamino]anilino]-3-oxopropanoate |
| SMILES | COC(=O)C(F)(F)C(=O)Nc1cc(NC(=O)C=Cc2c(OC)cc(OC)cc2OC)ccc1OC |
| InChI | InChI=1S/C23H24F2N2O8/c1-31-14-11-18(33-3)15(19(12-14)34-4)7-9-20(28)26-13-6-8-17(32-2)16(10-13)27-21(29)23(24,25)22(30)35-5/h6-12H,1-5H3,(H,26,28)(H,27,29) |
| InChIKey | LXZQACLZDZJNBN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 121.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|