C22H26N2O7 — CID 10342644
3-[2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]anilino]propanoic acid (PubChem CID 10342644) has the molecular formula C22H26N2O7 and a molecular weight of 430.46 g/mol. Its IUPAC name is 3-[2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]anilino]propanoic acid.
| Compound Name | 3-[2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]anilino]propanoic acid |
|---|---|
| PubChem CID | 10342644 |
| Molecular Formula | C22H26N2O7 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 3-[2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]anilino]propanoic acid |
| SMILES | COc1cc(OC)c(/C=C/C(=O)Nc2ccc(OC)c(NCCC(=O)O)c2)c(OC)c1 |
| InChI | InChI=1S/C22H26N2O7/c1-28-15-12-19(30-3)16(20(13-15)31-4)6-8-21(25)24-14-5-7-18(29-2)17(11-14)23-10-9-22(26)27/h5-8,11-13,23H,9-10H2,1-4H3,(H,24,25)(H,26,27)/b8-6+ |
| InChIKey | SNGAVYLZXPRUAS-SOFGYWHQSA-N |
| XLogP | 3.26 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|