C22H25NO8 — CID 87270050
2-hydroxy-2-[2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]propanoic acid (PubChem CID 87270050) has the molecular formula C22H25NO8 and a molecular weight of 431.44 g/mol. Its IUPAC name is 2-hydroxy-2-[2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]propanoic acid.
| Compound Name | 2-hydroxy-2-[2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 87270050 |
| Molecular Formula | C22H25NO8 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 2-hydroxy-2-[2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]propanoic acid |
| SMILES | COc1cc(OC)c(/C=C/C(=O)Nc2ccc(OC)c(C(C)(O)C(=O)O)c2)c(OC)c1 |
| InChI | InChI=1S/C22H25NO8/c1-22(27,21(25)26)16-10-13(6-8-17(16)29-3)23-20(24)9-7-15-18(30-4)11-14(28-2)12-19(15)31-5/h6-12,27H,1-5H3,(H,23,24)(H,25,26)/b9-7+ |
| InChIKey | PWCWTWUEUBKUPF-VQHVLOKHSA-N |
| XLogP | 2.66 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|