C19H22NO9P — CID 67102938
[2-methoxy-5-[3-(2,4,6-trimethoxyphenyl)prop-2-enoylamino]phenyl] dihydrogen phosphate (PubChem CID 67102938) has the molecular formula C19H22NO9P and a molecular weight of 439.36 g/mol. Its IUPAC name is [2-methoxy-5-[3-(2,4,6-trimethoxyphenyl)prop-2-enoylamino]phenyl] dihydrogen phosphate.
| Compound Name | [2-methoxy-5-[3-(2,4,6-trimethoxyphenyl)prop-2-enoylamino]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 67102938 |
| Molecular Formula | C19H22NO9P |
| Molecular Weight | 439.36 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | [2-methoxy-5-[3-(2,4,6-trimethoxyphenyl)prop-2-enoylamino]phenyl] dihydrogen phosphate |
| SMILES | COc1cc(OC)c(C=CC(=O)Nc2ccc(OC)c(OP(=O)(O)O)c2)c(OC)c1 |
| InChI | InChI=1S/C19H22NO9P/c1-25-13-10-16(27-3)14(17(11-13)28-4)6-8-19(21)20-12-5-7-15(26-2)18(9-12)29-30(22,23)24/h5-11H,1-4H3,(H,20,21)(H2,22,23,24) |
| InChIKey | UUBNUERKOFMFCH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 132.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|