C26H28N4O6 — CID 68955710
3,5-diamino-N-[2-methoxy-5-[3-(2,4,6-trimethoxyphenyl)prop-2-enoylamino]phenyl]benzamide (PubChem CID 68955710) has the molecular formula C26H28N4O6 and a molecular weight of 492.53 g/mol. Its IUPAC name is 3,5-diamino-N-[2-methoxy-5-[3-(2,4,6-trimethoxyphenyl)prop-2-enoylamino]phenyl]benzamide.
| Compound Name | 3,5-diamino-N-[2-methoxy-5-[3-(2,4,6-trimethoxyphenyl)prop-2-enoylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 68955710 |
| Molecular Formula | C26H28N4O6 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 3,5-diamino-N-[2-methoxy-5-[3-(2,4,6-trimethoxyphenyl)prop-2-enoylamino]phenyl]benzamide |
| SMILES | COc1cc(OC)c(C=CC(=O)Nc2ccc(OC)c(NC(=O)c3cc(N)cc(N)c3)c2)c(OC)c1 |
| InChI | InChI=1S/C26H28N4O6/c1-33-19-13-23(35-3)20(24(14-19)36-4)6-8-25(31)29-18-5-7-22(34-2)21(12-18)30-26(32)15-9-16(27)11-17(28)10-15/h5-14H,27-28H2,1-4H3,(H,29,31)(H,30,32) |
| InChIKey | BHEGQTOXRTUDQK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 147.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|