C26H26N2O7 — CID 87270218
4-amino-2-[2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]benzoic acid (PubChem CID 87270218) has the molecular formula C26H26N2O7 and a molecular weight of 478.50 g/mol. Its IUPAC name is 4-amino-2-[2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]benzoic acid.
| Compound Name | 4-amino-2-[2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]benzoic acid |
|---|---|
| PubChem CID | 87270218 |
| Molecular Formula | C26H26N2O7 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 4-amino-2-[2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]benzoic acid |
| SMILES | COc1cc(OC)c(/C=C/C(=O)Nc2ccc(OC)c(-c3cc(N)ccc3C(=O)O)c2)c(OC)c1 |
| InChI | InChI=1S/C26H26N2O7/c1-32-17-13-23(34-3)19(24(14-17)35-4)8-10-25(29)28-16-6-9-22(33-2)21(12-16)20-11-15(27)5-7-18(20)26(30)31/h5-14H,27H2,1-4H3,(H,28,29)(H,30,31)/b10-8+ |
| InChIKey | JPZPZFFUVPDOBQ-CSKARUKUSA-N |
| XLogP | 4.32 |
| TPSA | 129.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|