C26H25NO7 — CID 67103271
[2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]phenyl] benzoate (PubChem CID 67103271) has the molecular formula C26H25NO7 and a molecular weight of 463.49 g/mol. Its IUPAC name is [2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]phenyl] benzoate.
| Compound Name | [2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]phenyl] benzoate |
|---|---|
| PubChem CID | 67103271 |
| Molecular Formula | C26H25NO7 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | [2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]phenyl] benzoate |
| SMILES | COc1cc(OC)c(/C=C/C(=O)Nc2ccc(OC)c(OC(=O)c3ccccc3)c2)c(OC)c1 |
| InChI | InChI=1S/C26H25NO7/c1-30-19-15-22(32-3)20(23(16-19)33-4)11-13-25(28)27-18-10-12-21(31-2)24(14-18)34-26(29)17-8-6-5-7-9-17/h5-16H,1-4H3,(H,27,28)/b13-11+ |
| InChIKey | PMQBZYCKVFIMIY-ACCUITESSA-N |
| XLogP | 4.59 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|