C22H23NO9 — CID 11419427
3-[2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]phenoxy]-3-oxopropanoic acid (PubChem CID 11419427) has the molecular formula C22H23NO9 and a molecular weight of 445.42 g/mol. Its IUPAC name is 3-[2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]phenoxy]-3-oxopropanoic acid.
| Compound Name | 3-[2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]phenoxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 11419427 |
| Molecular Formula | C22H23NO9 |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 3-[2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]phenoxy]-3-oxopropanoic acid |
| SMILES | COc1cc(OC)c(/C=C/C(=O)Nc2ccc(OC)c(OC(=O)CC(=O)O)c2)c(OC)c1 |
| InChI | InChI=1S/C22H23NO9/c1-28-14-10-17(30-3)15(18(11-14)31-4)6-8-20(24)23-13-5-7-16(29-2)19(9-13)32-22(27)12-21(25)26/h5-11H,12H2,1-4H3,(H,23,24)(H,25,26)/b8-6+ |
| InChIKey | PJGGKHBOFQFGHB-SOFGYWHQSA-N |
| XLogP | 2.75 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|