C23H27NO8 — CID 87270117
2-hydroxy-3-[2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]-2-methylpropanoic acid (PubChem CID 87270117) has the molecular formula C23H27NO8 and a molecular weight of 445.47 g/mol. Its IUPAC name is 2-hydroxy-3-[2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]-2-methylpropanoic acid.
| Compound Name | 2-hydroxy-3-[2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 87270117 |
| Molecular Formula | C23H27NO8 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 2-hydroxy-3-[2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]-2-methylpropanoic acid |
| SMILES | COc1cc(OC)c(/C=C/C(=O)Nc2ccc(OC)c(CC(C)(O)C(=O)O)c2)c(OC)c1 |
| InChI | InChI=1S/C23H27NO8/c1-23(28,22(26)27)13-14-10-15(6-8-18(14)30-3)24-21(25)9-7-17-19(31-4)11-16(29-2)12-20(17)32-5/h6-12,28H,13H2,1-5H3,(H,24,25)(H,26,27)/b9-7+ |
| InChIKey | ZORITIQKOCIAQM-VQHVLOKHSA-N |
| XLogP | 2.75 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|