C21H23NO8 — CID 67102694
[2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]phenyl] 2-hydroxyacetate (PubChem CID 67102694) has the molecular formula C21H23NO8 and a molecular weight of 417.41 g/mol. Its IUPAC name is [2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]phenyl] 2-hydroxyacetate.
| Compound Name | [2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]phenyl] 2-hydroxyacetate |
|---|---|
| PubChem CID | 67102694 |
| Molecular Formula | C21H23NO8 |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | [2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]phenyl] 2-hydroxyacetate |
| SMILES | COc1cc(OC)c(/C=C/C(=O)Nc2ccc(OC)c(OC(=O)CO)c2)c(OC)c1 |
| InChI | InChI=1S/C21H23NO8/c1-26-14-10-17(28-3)15(18(11-14)29-4)6-8-20(24)22-13-5-7-16(27-2)19(9-13)30-21(25)12-23/h5-11,23H,12H2,1-4H3,(H,22,24)/b8-6+ |
| InChIKey | WRJUPTYKQQETFQ-SOFGYWHQSA-N |
| XLogP | 2.27 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|