C25H23N3O12S — CID 87269808
[2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]phenyl] 2,4-dinitrobenzenesulfonate (PubChem CID 87269808) has the molecular formula C25H23N3O12S and a molecular weight of 589.54 g/mol. Its IUPAC name is [2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]phenyl] 2,4-dinitrobenzenesulfonate.
| Compound Name | [2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]phenyl] 2,4-dinitrobenzenesulfonate |
|---|---|
| PubChem CID | 87269808 |
| Molecular Formula | C25H23N3O12S |
| Molecular Weight | 589.54 g/mol |
| Exact Mass | 589.10 |
| IUPAC Name | [2-methoxy-5-[[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoyl]amino]phenyl] 2,4-dinitrobenzenesulfonate |
| SMILES | COc1cc(OC)c(/C=C/C(=O)Nc2ccc(OC)c(OS(=O)(=O)c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c2)c(OC)c1 |
| InChI | InChI=1S/C25H23N3O12S/c1-36-17-13-21(38-3)18(22(14-17)39-4)7-10-25(29)26-15-5-8-20(37-2)23(11-15)40-41(34,35)24-9-6-16(27(30)31)12-19(24)28(32)33/h5-14H,1-4H3,(H,26,29)/b10-7+ |
| InChIKey | GTNJTYCDIQUHLJ-JXMROGBWSA-N |
| XLogP | 3.96 |
| TPSA | 195.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|