C24H37N5O7S — CID 67318094
N-(3-amino-4-methoxyphenyl)-2-(2,4,6-trimethoxyphenyl)ethenesulfonamide;(2S)-2,6-diaminohexanamide (PubChem CID 67318094) has the molecular formula C24H37N5O7S and a molecular weight of 539.66 g/mol. Its IUPAC name is N-(3-amino-4-methoxyphenyl)-2-(2,4,6-trimethoxyphenyl)ethenesulfonamide;(2S)-2,6-diaminohexanamide.
| Compound Name | N-(3-amino-4-methoxyphenyl)-2-(2,4,6-trimethoxyphenyl)ethenesulfonamide;(2S)-2,6-diaminohexanamide |
|---|---|
| PubChem CID | 67318094 |
| Molecular Formula | C24H37N5O7S |
| Molecular Weight | 539.66 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | N-(3-amino-4-methoxyphenyl)-2-(2,4,6-trimethoxyphenyl)ethenesulfonamide;(2S)-2,6-diaminohexanamide |
| SMILES | COc1cc(OC)c(C=CS(=O)(=O)Nc2ccc(OC)c(N)c2)c(OC)c1.NCCCC[C@H](N)C(N)=O |
| InChI | InChI=1S/C18H22N2O6S.C6H15N3O/c1-23-13-10-17(25-3)14(18(11-13)26-4)7-8-27(21,22)20-12-5-6-16(24-2)15(19)9-12;7-4-2-1-3-5(8)6(9)10/h5-11,20H,19H2,1-4H3;5H,1-4,7-8H2,(H2,9,10)/t;5-/m.0/s1 |
| InChIKey | QVZXOGMIPAJXCN-ZSCHJXSPSA-N |
| XLogP | 1.64 |
| TPSA | 204.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.66 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|