C24H36N4O5 — CID 67567560
(2R)-2,6-diaminohexanamide;2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]aniline (PubChem CID 67567560) has the molecular formula C24H36N4O5 and a molecular weight of 460.58 g/mol. Its IUPAC name is (2R)-2,6-diaminohexanamide;2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]aniline.
| Compound Name | (2R)-2,6-diaminohexanamide;2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]aniline |
|---|---|
| PubChem CID | 67567560 |
| Molecular Formula | C24H36N4O5 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | (2R)-2,6-diaminohexanamide;2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]aniline |
| SMILES | COc1ccc(C=Cc2cc(OC)c(OC)c(OC)c2)cc1N.NCCCC[C@@H](N)C(N)=O |
| InChI | InChI=1S/C18H21NO4.C6H15N3O/c1-20-15-8-7-12(9-14(15)19)5-6-13-10-16(21-2)18(23-4)17(11-13)22-3;7-4-2-1-3-5(8)6(9)10/h5-11H,19H2,1-4H3;5H,1-4,7-8H2,(H2,9,10)/t;5-/m.1/s1 |
| InChIKey | UXKACZIACWDILZ-QDXATWJZSA-N |
| XLogP | 2.40 |
| TPSA | 158.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|