C23H29N5O6 — CID 22877846
(2S)-2-aminobutanediamide;(E)-3-(3-amino-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)prop-2-enenitrile (PubChem CID 22877846) has the molecular formula C23H29N5O6 and a molecular weight of 471.51 g/mol. Its IUPAC name is (2S)-2-aminobutanediamide;(E)-3-(3-amino-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)prop-2-enenitrile.
| Compound Name | (2S)-2-aminobutanediamide;(E)-3-(3-amino-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 22877846 |
| Molecular Formula | C23H29N5O6 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | (2S)-2-aminobutanediamide;(E)-3-(3-amino-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)prop-2-enenitrile |
| SMILES | COc1ccc(/C=C(/C#N)c2cc(OC)c(OC)c(OC)c2)cc1N.NC(=O)C[C@H](N)C(N)=O |
| InChI | InChI=1S/C19H20N2O4.C4H9N3O2/c1-22-16-6-5-12(8-15(16)21)7-14(11-20)13-9-17(23-2)19(25-4)18(10-13)24-3;5-2(4(7)9)1-3(6)8/h5-10H,21H2,1-4H3;2H,1,5H2,(H2,6,8)(H2,7,9)/b14-7-;/t;2-/m.0/s1 |
| InChIKey | AJGNXPTWGWUPEX-HMUHETQKSA-N |
| XLogP | 1.04 |
| TPSA | 198.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|