C56H58N6O12 — CID 173339102
bis(3-(3-amino-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)prop-2-enenitrile);9H-fluoren-9-ylmethyl N-[(2S)-1-amino-3-hydroxy-1-oxopropan-2-yl]carbamate (PubChem CID 173339102) has the molecular formula C56H58N6O12 and a molecular weight of 1007.11 g/mol. Its IUPAC name is bis(3-(3-amino-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)prop-2-enenitrile);9H-fluoren-9-ylmethyl N-[(2S)-1-amino-3-hydroxy-1-oxopropan-2-yl]carbamate.
| Compound Name | bis(3-(3-amino-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)prop-2-enenitrile);9H-fluoren-9-ylmethyl N-[(2S)-1-amino-3-hydroxy-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 173339102 |
| Molecular Formula | C56H58N6O12 |
| Molecular Weight | 1007.11 g/mol |
| Exact Mass | 1006.41 |
| IUPAC Name | bis(3-(3-amino-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)prop-2-enenitrile);9H-fluoren-9-ylmethyl N-[(2S)-1-amino-3-hydroxy-1-oxopropan-2-yl]carbamate |
| SMILES | COc1ccc(C=C(C#N)c2cc(OC)c(OC)c(OC)c2)cc1N.COc1ccc(C=C(C#N)c2cc(OC)c(OC)c(OC)c2)cc1N.NC(=O)[C@H](CO)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/2C19H20N2O4.C18H18N2O4/c2*1-22-16-6-5-12(8-15(16)21)7-14(11-20)13-9-17(23-2)19(25-4)18(10-13)24-3;19-17(22)16(9-21)20-18(23)24-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h2*5-10H,21H2,1-4H3;1-8,15-16,21H,9-10H2,(H2,19,22)(H,20,23)/t;;16-/m..0/s1 |
| InChIKey | CQDYPEFUAZHZQZ-MDVHDPGASA-N |
| XLogP | 8.11 |
| TPSA | 275.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1007.11 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|