C39H45N3O7 — CID 22877917
9H-fluoren-9-ylmethyl N-[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]carbamate;2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline (PubChem CID 22877917) has the molecular formula C39H45N3O7 and a molecular weight of 667.80 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]carbamate;2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]carbamate;2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline |
|---|---|
| PubChem CID | 22877917 |
| Molecular Formula | C39H45N3O7 |
| Molecular Weight | 667.80 g/mol |
| Exact Mass | 667.33 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]carbamate;2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline |
| SMILES | CC(C)C[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(N)=O.COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1N |
| InChI | InChI=1S/C21H24N2O3.C18H21NO4/c1-13(2)11-19(20(22)24)23-21(25)26-12-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18;1-20-15-8-7-12(9-14(15)19)5-6-13-10-16(21-2)18(23-4)17(11-13)22-3/h3-10,13,18-19H,11-12H2,1-2H3,(H2,22,24)(H,23,25);5-11H,19H2,1-4H3/b;6-5-/t19-;/m0./s1 |
| InChIKey | CYWBMKQFCAKDDY-GCRZSTFDSA-N |
| XLogP | 6.90 |
| TPSA | 144.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.80 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|