C38H38N2O9 — CID 75110781
[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-3-oxopropyl] acetate (PubChem CID 75110781) has the molecular formula C38H38N2O9 and a molecular weight of 666.73 g/mol. Its IUPAC name is [2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-3-oxopropyl] acetate.
| Compound Name | [2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-3-oxopropyl] acetate |
|---|---|
| PubChem CID | 75110781 |
| Molecular Formula | C38H38N2O9 |
| Molecular Weight | 666.73 g/mol |
| Exact Mass | 666.26 |
| IUPAC Name | [2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-3-oxopropyl] acetate |
| SMILES | COc1ccc(C=Cc2cc(OC)c(OC)c(OC)c2)cc1NC(=O)C(COC(C)=O)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C38H38N2O9/c1-23(41)48-22-32(40-38(43)49-21-30-28-12-8-6-10-26(28)27-11-7-9-13-29(27)30)37(42)39-31-18-24(16-17-33(31)44-2)14-15-25-19-34(45-3)36(47-5)35(20-25)46-4/h6-20,30,32H,21-22H2,1-5H3,(H,39,42)(H,40,43) |
| InChIKey | NXNGTIBMZZDBRE-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 130.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.73 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|