C30H45N9O6 — CID 155551697
(2S)-2-amino-5-(diaminomethylideneamino)-N-[(2S)-5-(diaminomethylideneamino)-1-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-1-oxopentan-2-yl]pentanamide (PubChem CID 155551697) has the molecular formula C30H45N9O6 and a molecular weight of 627.75 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)-N-[(2S)-5-(diaminomethylideneamino)-1-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-1-oxopentan-2-yl]pentanamide.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)-N-[(2S)-5-(diaminomethylideneamino)-1-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-1-oxopentan-2-yl]pentanamide |
|---|---|
| PubChem CID | 155551697 |
| Molecular Formula | C30H45N9O6 |
| Molecular Weight | 627.75 g/mol |
| Exact Mass | 627.35 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)-N-[(2S)-5-(diaminomethylideneamino)-1-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-1-oxopentan-2-yl]pentanamide |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C30H45N9O6/c1-42-23-12-11-18(9-10-19-16-24(43-2)26(45-4)25(17-19)44-3)15-22(23)39-28(41)21(8-6-14-37-30(34)35)38-27(40)20(31)7-5-13-36-29(32)33/h9-12,15-17,20-21H,5-8,13-14,31H2,1-4H3,(H,38,40)(H,39,41)(H4,32,33,36)(H4,34,35,37)/b10-9-/t20-,21-/m0/s1 |
| InChIKey | REJZDTRORBLDTE-KFKZIDAKSA-N |
| XLogP | 0.75 |
| TPSA | 249.94 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.75 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|