C31H40N8O10 — CID 58712190
3-amino-4-[[2-[[5-(diaminomethylideneamino)-1-[2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)-1,2-oxazol-4-yl]anilino]-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-4-oxobutanoic acid (PubChem CID 58712190) has the molecular formula C31H40N8O10 and a molecular weight of 684.71 g/mol. Its IUPAC name is 3-amino-4-[[2-[[5-(diaminomethylideneamino)-1-[2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)-1,2-oxazol-4-yl]anilino]-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[[2-[[5-(diaminomethylideneamino)-1-[2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)-1,2-oxazol-4-yl]anilino]-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 58712190 |
| Molecular Formula | C31H40N8O10 |
| Molecular Weight | 684.71 g/mol |
| Exact Mass | 684.29 |
| IUPAC Name | 3-amino-4-[[2-[[5-(diaminomethylideneamino)-1-[2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)-1,2-oxazol-4-yl]anilino]-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-4-oxobutanoic acid |
| SMILES | COc1ccc(-c2conc2-c2cc(OC)c(OC)c(OC)c2)cc1NC(=O)C(CCCN=C(N)N)NC(=O)CNC(=O)C(N)CC(=O)O |
| InChI | InChI=1S/C31H40N8O10/c1-45-22-8-7-16(18-15-49-39-27(18)17-11-23(46-2)28(48-4)24(12-17)47-3)10-21(22)38-30(44)20(6-5-9-35-31(33)34)37-25(40)14-36-29(43)19(32)13-26(41)42/h7-8,10-12,15,19-20H,5-6,9,13-14,32H2,1-4H3,(H,36,43)(H,37,40)(H,38,44)(H,41,42)(H4,33,34,35) |
| InChIKey | KXYOMIFZKDHKEV-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 277.97 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.71 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|