C25H33ClN6O6 — CID 87207885
[5-(diaminomethylideneamino)-1-[2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)-1,2-oxazol-4-yl]anilino]-1-oxopentan-2-yl]azanium chloride (PubChem CID 87207885) has the molecular formula C25H33ClN6O6 and a molecular weight of 549.03 g/mol. Its IUPAC name is [5-(diaminomethylideneamino)-1-[2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)-1,2-oxazol-4-yl]anilino]-1-oxopentan-2-yl]azanium chloride.
| Compound Name | [5-(diaminomethylideneamino)-1-[2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)-1,2-oxazol-4-yl]anilino]-1-oxopentan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 87207885 |
| Molecular Formula | C25H33ClN6O6 |
| Molecular Weight | 549.03 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | [5-(diaminomethylideneamino)-1-[2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)-1,2-oxazol-4-yl]anilino]-1-oxopentan-2-yl]azanium chloride |
| SMILES | COc1ccc(-c2conc2-c2cc(OC)c(OC)c(OC)c2)cc1NC(=O)C([NH3+])CCCN=C(N)N.[Cl-] |
| InChI | InChI=1S/C25H32N6O6.ClH/c1-33-19-8-7-14(10-18(19)30-24(32)17(26)6-5-9-29-25(27)28)16-13-37-31-22(16)15-11-20(34-2)23(36-4)21(12-15)35-3;/h7-8,10-13,17H,5-6,9,26H2,1-4H3,(H,30,32)(H4,27,28,29);1H |
| InChIKey | YEUBZCDHPKAGDI-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 184.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.03 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|