C25H31ClN4O6 — CID 149058195
6-amino-2-(chloroamino)-N-[2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)-1,2-oxazol-4-yl]phenyl]hexanamide (PubChem CID 149058195) has the molecular formula C25H31ClN4O6 and a molecular weight of 519.00 g/mol. Its IUPAC name is 6-amino-2-(chloroamino)-N-[2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)-1,2-oxazol-4-yl]phenyl]hexanamide.
| Compound Name | 6-amino-2-(chloroamino)-N-[2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)-1,2-oxazol-4-yl]phenyl]hexanamide |
|---|---|
| PubChem CID | 149058195 |
| Molecular Formula | C25H31ClN4O6 |
| Molecular Weight | 519.00 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | 6-amino-2-(chloroamino)-N-[2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)-1,2-oxazol-4-yl]phenyl]hexanamide |
| SMILES | COc1ccc(-c2conc2-c2cc(OC)c(OC)c(OC)c2)cc1NC(=O)C(CCCCN)NCl |
| InChI | InChI=1S/C25H31ClN4O6/c1-32-20-9-8-15(11-19(20)28-25(31)18(29-26)7-5-6-10-27)17-14-36-30-23(17)16-12-21(33-2)24(35-4)22(13-16)34-3/h8-9,11-14,18,29H,5-7,10,27H2,1-4H3,(H,28,31) |
| InChIKey | QLGHZPFKHNVHFJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 130.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.00 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|