C29H31NO7 — CID 134197468
(E)-3-(3,4-dimethoxyphenyl)-N-[2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide (PubChem CID 134197468) has the molecular formula C29H31NO7 and a molecular weight of 505.57 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-[2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-[2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 134197468 |
| Molecular Formula | C29H31NO7 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-[2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/c2cc(OC)c(OC)c(OC)c2)cc1NC(=O)/C=C/c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C29H31NO7/c1-32-23-12-9-19(7-8-21-17-26(35-4)29(37-6)27(18-21)36-5)15-22(23)30-28(31)14-11-20-10-13-24(33-2)25(16-20)34-3/h7-18H,1-6H3,(H,30,31)/b8-7+,14-11+ |
| InChIKey | FZCRNLJLGZSQNG-DQBULIGTSA-N |
| XLogP | 5.56 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|