C28H28N2O8 — CID 135360292
(E)-3-(3-methoxy-4-nitrophenyl)-N-[2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide (PubChem CID 135360292) has the molecular formula C28H28N2O8 and a molecular weight of 520.54 g/mol. Its IUPAC name is (E)-3-(3-methoxy-4-nitrophenyl)-N-[2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3-methoxy-4-nitrophenyl)-N-[2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 135360292 |
| Molecular Formula | C28H28N2O8 |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | (E)-3-(3-methoxy-4-nitrophenyl)-N-[2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide |
| SMILES | COc1ccc(C=Cc2cc(OC)c(OC)c(OC)c2)cc1NC(=O)/C=C/c1ccc([N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C28H28N2O8/c1-34-23-12-9-18(6-7-20-16-25(36-3)28(38-5)26(17-20)37-4)14-21(23)29-27(31)13-10-19-8-11-22(30(32)33)24(15-19)35-2/h6-17H,1-5H3,(H,29,31)/b7-6?,13-10+ |
| InChIKey | UYALURZTZAGANA-ZAWWDXNVSA-N |
| XLogP | 5.46 |
| TPSA | 118.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|