C28H28N2O9 — CID 135360114
(E)-N-[2-hydroxy-3-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-3-(4-methoxy-3-nitrophenyl)prop-2-enamide (PubChem CID 135360114) has the molecular formula C28H28N2O9 and a molecular weight of 536.54 g/mol. Its IUPAC name is (E)-N-[2-hydroxy-3-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-3-(4-methoxy-3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-hydroxy-3-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-3-(4-methoxy-3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 135360114 |
| Molecular Formula | C28H28N2O9 |
| Molecular Weight | 536.54 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | (E)-N-[2-hydroxy-3-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-3-(4-methoxy-3-nitrophenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2cc(/C=C/c3cc(OC)c(OC)c(OC)c3)cc(OC)c2O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H28N2O9/c1-35-22-10-8-17(13-21(22)30(33)34)9-11-26(31)29-20-12-18(14-23(36-2)27(20)32)6-7-19-15-24(37-3)28(39-5)25(16-19)38-4/h6-16,32H,1-5H3,(H,29,31)/b7-6+,11-9+ |
| InChIKey | QBVOGVWAQXMMJV-RXUIJTJXSA-N |
| XLogP | 5.17 |
| TPSA | 138.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.54 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|