C21H26N2O6 — CID 10203538
(2S)-3-hydroxy-2-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]propanamide (PubChem CID 10203538) has the molecular formula C21H26N2O6 and a molecular weight of 402.45 g/mol. Its IUPAC name is (2S)-3-hydroxy-2-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]propanamide.
| Compound Name | (2S)-3-hydroxy-2-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]propanamide |
|---|---|
| PubChem CID | 10203538 |
| Molecular Formula | C21H26N2O6 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (2S)-3-hydroxy-2-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]propanamide |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1N[C@@H](CO)C(N)=O |
| InChI | InChI=1S/C21H26N2O6/c1-26-17-8-7-13(9-15(17)23-16(12-24)21(22)25)5-6-14-10-18(27-2)20(29-4)19(11-14)28-3/h5-11,16,23-24H,12H2,1-4H3,(H2,22,25)/b6-5-/t16-/m0/s1 |
| InChIKey | JRNWPLTZMVVQMB-KJPDOMRESA-N |
| XLogP | 2.15 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|