C19H25O9P — CID 69301542
5-[2-(3,4-dimethoxyphenyl)ethenyl]-1,2,3-trimethoxybenzene;phosphoric acid (PubChem CID 69301542) has the molecular formula C19H25O9P and a molecular weight of 428.37 g/mol. Its IUPAC name is 5-[2-(3,4-dimethoxyphenyl)ethenyl]-1,2,3-trimethoxybenzene;phosphoric acid.
| Compound Name | 5-[2-(3,4-dimethoxyphenyl)ethenyl]-1,2,3-trimethoxybenzene;phosphoric acid |
|---|---|
| PubChem CID | 69301542 |
| Molecular Formula | C19H25O9P |
| Molecular Weight | 428.37 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 5-[2-(3,4-dimethoxyphenyl)ethenyl]-1,2,3-trimethoxybenzene;phosphoric acid |
| SMILES | COc1ccc(C=Cc2cc(OC)c(OC)c(OC)c2)cc1OC.O=P(O)(O)O |
| InChI | InChI=1S/C19H22O5.H3O4P/c1-20-15-9-8-13(10-16(15)21-2)6-7-14-11-17(22-3)19(24-5)18(12-14)23-4;1-5(2,3)4/h6-12H,1-5H3;(H3,1,2,3,4) |
| InChIKey | OXQOSTCFQZOVEY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|