C18H22NaO12P2+ — CID 10142508
sodium [2-methoxy-3-phosphonooxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] dihydrogen phosphate (PubChem CID 10142508) has the molecular formula C18H22NaO12P2+ and a molecular weight of 515.30 g/mol. Its IUPAC name is sodium [2-methoxy-3-phosphonooxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] dihydrogen phosphate.
| Compound Name | sodium [2-methoxy-3-phosphonooxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 10142508 |
| Molecular Formula | C18H22NaO12P2+ |
| Molecular Weight | 515.30 g/mol |
| Exact Mass | 515.05 |
| IUPAC Name | sodium [2-methoxy-3-phosphonooxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] dihydrogen phosphate |
| SMILES | COc1cc(/C=C\c2cc(OP(=O)(O)O)c(OC)c(OP(=O)(O)O)c2)cc(OC)c1OC.[Na+] |
| InChI | InChI=1S/C18H22O12P2.Na/c1-25-13-7-11(8-14(26-2)17(13)27-3)5-6-12-9-15(29-31(19,20)21)18(28-4)16(10-12)30-32(22,23)24;/h5-10H,1-4H3,(H2,19,20,21)(H2,22,23,24);/q;+1/b6-5-; |
| InChIKey | BCQCZHKHXITSDC-YSMBQZINSA-N |
| XLogP | -0.16 |
| TPSA | 170.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.30 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|