C33H31O8P — CID 71416239
[2,3-dibenzyl-6-[2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzofuran-4-yl] dihydrogen phosphate (PubChem CID 71416239) has the molecular formula C33H31O8P and a molecular weight of 586.58 g/mol. Its IUPAC name is [2,3-dibenzyl-6-[2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzofuran-4-yl] dihydrogen phosphate.
| Compound Name | [2,3-dibenzyl-6-[2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzofuran-4-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 71416239 |
| Molecular Formula | C33H31O8P |
| Molecular Weight | 586.58 g/mol |
| Exact Mass | 586.18 |
| IUPAC Name | [2,3-dibenzyl-6-[2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzofuran-4-yl] dihydrogen phosphate |
| SMILES | COc1cc(C=Cc2cc(OP(=O)(O)O)c3c(Cc4ccccc4)c(Cc4ccccc4)oc3c2)cc(OC)c1OC |
| InChI | InChI=1S/C33H31O8P/c1-37-30-20-25(21-31(38-2)33(30)39-3)15-14-24-18-28-32(29(19-24)41-42(34,35)36)26(16-22-10-6-4-7-11-22)27(40-28)17-23-12-8-5-9-13-23/h4-15,18-21H,16-17H2,1-3H3,(H2,34,35,36) |
| InChIKey | ZWWBKQWRWADBQC-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.58 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|