C17H18O3Se — CID 46201364
1,2,3-trimethoxy-5-[(E)-2-phenylselanylethenyl]benzene (PubChem CID 46201364) has the molecular formula C17H18O3Se and a molecular weight of 349.29 g/mol. Its IUPAC name is 1,2,3-trimethoxy-5-[(E)-2-phenylselanylethenyl]benzene.
| Compound Name | 1,2,3-trimethoxy-5-[(E)-2-phenylselanylethenyl]benzene |
|---|---|
| PubChem CID | 46201364 |
| Molecular Formula | C17H18O3Se |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 1,2,3-trimethoxy-5-[(E)-2-phenylselanylethenyl]benzene |
| SMILES | COc1cc(/C=C/[Se]c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C17H18O3Se/c1-18-15-11-13(12-16(19-2)17(15)20-3)9-10-21-14-7-5-4-6-8-14/h4-12H,1-3H3/b10-9+ |
| InChIKey | LRKVACQNVBYZER-MDZDMXLPSA-N |
| XLogP | 2.71 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|