C12H13F3O3Se — CID 122369230
1,2,3-trimethoxy-5-[(E)-2-(trifluoromethylselanyl)ethenyl]benzene (PubChem CID 122369230) has the molecular formula C12H13F3O3Se and a molecular weight of 341.19 g/mol. Its IUPAC name is 1,2,3-trimethoxy-5-[(E)-2-(trifluoromethylselanyl)ethenyl]benzene.
| Compound Name | 1,2,3-trimethoxy-5-[(E)-2-(trifluoromethylselanyl)ethenyl]benzene |
|---|---|
| PubChem CID | 122369230 |
| Molecular Formula | C12H13F3O3Se |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 1,2,3-trimethoxy-5-[(E)-2-(trifluoromethylselanyl)ethenyl]benzene |
| SMILES | COc1cc(/C=C/[Se]C(F)(F)F)cc(OC)c1OC |
| InChI | InChI=1S/C12H13F3O3Se/c1-16-9-6-8(4-5-19-12(13,14)15)7-10(17-2)11(9)18-3/h4-7H,1-3H3/b5-4+ |
| InChIKey | UFSKFVVCYVNTPQ-SNAWJCMRSA-N |
| XLogP | 2.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|