C19H22O6 — CID 69302242
2,3-dimethoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenol (PubChem CID 69302242) has the molecular formula C19H22O6 and a molecular weight of 346.38 g/mol. Its IUPAC name is 2,3-dimethoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenol.
| Compound Name | 2,3-dimethoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenol |
|---|---|
| PubChem CID | 69302242 |
| Molecular Formula | C19H22O6 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2,3-dimethoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenol |
| SMILES | COc1cc(C=Cc2cc(OC)c(OC)c(OC)c2)cc(O)c1OC |
| InChI | InChI=1S/C19H22O6/c1-21-15-9-12(8-14(20)18(15)24-4)6-7-13-10-16(22-2)19(25-5)17(11-13)23-3/h6-11,20H,1-5H3 |
| InChIKey | AOKFYXSBWTUOGD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|