C19H19NO3Y — CID 177336882
2,3-dimethoxy-5-[(Z)-2-(1-methylindol-5-yl)ethenyl]phenol;yttrium (PubChem CID 177336882) has the molecular formula C19H19NO3Y and a molecular weight of 398.27 g/mol. Its IUPAC name is 2,3-dimethoxy-5-[(Z)-2-(1-methylindol-5-yl)ethenyl]phenol;yttrium.
| Compound Name | 2,3-dimethoxy-5-[(Z)-2-(1-methylindol-5-yl)ethenyl]phenol;yttrium |
|---|---|
| PubChem CID | 177336882 |
| Molecular Formula | C19H19NO3Y |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | 2,3-dimethoxy-5-[(Z)-2-(1-methylindol-5-yl)ethenyl]phenol;yttrium |
| SMILES | COc1cc(/C=C\c2ccc3c(ccn3C)c2)cc(O)c1OC.[Y] |
| InChI | InChI=1S/C19H19NO3.Y/c1-20-9-8-15-10-13(6-7-16(15)20)4-5-14-11-17(21)19(23-3)18(12-14)22-2;/h4-12,21H,1-3H3;/b5-4-; |
| InChIKey | AVKHDMKCCIUACZ-MKWAYWHRSA-N |
| XLogP | 4.07 |
| TPSA | 43.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|