About 2-ethyl-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol
2-ethyl-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol (PubChem CID 139943086) has the molecular formula C19H22O4
and a molecular weight of 314.38 g/mol. Its IUPAC name is 2-ethyl-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol.
Molecular Properties
| Compound Name | 2-ethyl-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol |
| PubChem CID | 139943086 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 2-ethyl-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol |
| SMILES | CCc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1O |
| InChI | InChI=1S/C19H22O4/c1-5-15-9-8-13(10-16(15)20)6-7-14-11-17(21-2)19(23-4)18(12-14)22-3/h6-12,20H,5H2,1-4H3/b7-6- |
| InChIKey | QHCXRFFBXVBLKE-SREVYHEPSA-N |
| XLogP | 4.15 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol?
The IUPAC name of 2-ethyl-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol (CID 139943086) is 2-ethyl-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol.
What is the SMILES notation for 2-ethyl-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol?
The canonical SMILES for 2-ethyl-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol is CCc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1O.
What is the InChIKey of 2-ethyl-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol?
The InChIKey is QHCXRFFBXVBLKE-SREVYHEPSA-N. The full InChI is InChI=1S/C19H22O4/c1-5-15-9-8-13(10-16(15)20)6-7-14-11-17(21-2)19(23-4)18(12-14)22-3/h6-12,20H,5H2,1-4H3/b7-6-.
What are the key properties of 2-ethyl-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol?
2-ethyl-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol has a molecular weight of 314.38 g/mol, XLogP of 4.15, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol is sourced from PubChem (CID 139943086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).