C16H15FO4 — CID 72723769
5-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-2-fluorobenzene-1,3-diol (PubChem CID 72723769) has the molecular formula C16H15FO4 and a molecular weight of 290.29 g/mol. Its IUPAC name is 5-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-2-fluorobenzene-1,3-diol.
| Compound Name | 5-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-2-fluorobenzene-1,3-diol |
|---|---|
| PubChem CID | 72723769 |
| Molecular Formula | C16H15FO4 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 5-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-2-fluorobenzene-1,3-diol |
| SMILES | COc1ccc(/C=C/c2cc(O)c(F)c(O)c2)cc1OC |
| InChI | InChI=1S/C16H15FO4/c1-20-14-6-5-10(9-15(14)21-2)3-4-11-7-12(18)16(17)13(19)8-11/h3-9,18-19H,1-2H3/b4-3+ |
| InChIKey | YWQMOXAKUCTNCF-ONEGZZNKSA-N |
| XLogP | 3.42 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|