C15H9F5O2 — CID 87643228
2-methoxy-4-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]phenol (PubChem CID 87643228) has the molecular formula C15H9F5O2 and a molecular weight of 316.23 g/mol. Its IUPAC name is 2-methoxy-4-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]phenol.
| Compound Name | 2-methoxy-4-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]phenol |
|---|---|
| PubChem CID | 87643228 |
| Molecular Formula | C15H9F5O2 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 2-methoxy-4-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]phenol |
| SMILES | COc1cc(/C=C/c2c(F)c(F)c(F)c(F)c2F)ccc1O |
| InChI | InChI=1S/C15H9F5O2/c1-22-10-6-7(3-5-9(10)21)2-4-8-11(16)13(18)15(20)14(19)12(8)17/h2-6,21H,1H3/b4-2+ |
| InChIKey | QPHSCWQMHPHSAA-DUXPYHPUSA-N |
| XLogP | 4.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|