C21H24O6 — CID 11793638
(1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-diol (PubChem CID 11793638) has the molecular formula C21H24O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is (1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-diol.
| Compound Name | (1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-diol |
|---|---|
| PubChem CID | 11793638 |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | (1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-diol |
| SMILES | COc1cc(/C=C/C(O)CC(O)/C=C/c2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C21H24O6/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2/h3-12,16-17,22-25H,13H2,1-2H3/b7-3+,8-4+ |
| InChIKey | YRWBZMIJKPUIGZ-FCXRPNKRSA-N |
| XLogP | 2.95 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |