C9H12O2P2 — CID 143209626
4-[(E)-2-(diphosphanyl)ethenyl]-2-methoxyphenol (PubChem CID 143209626) has the molecular formula C9H12O2P2 and a molecular weight of 214.14 g/mol. Its IUPAC name is 4-[(E)-2-(diphosphanyl)ethenyl]-2-methoxyphenol.
| Compound Name | 4-[(E)-2-(diphosphanyl)ethenyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 143209626 |
| Molecular Formula | C9H12O2P2 |
| Molecular Weight | 214.14 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 4-[(E)-2-(diphosphanyl)ethenyl]-2-methoxyphenol |
| SMILES | COc1cc(/C=C/PP)ccc1O |
| InChI | InChI=1S/C9H12O2P2/c1-11-9-6-7(4-5-13-12)2-3-8(9)10/h2-6,10,13H,12H2,1H3/b5-4+ |
| InChIKey | RWZWXNMLBMNSOY-SNAWJCMRSA-N |
| XLogP | 2.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.14 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|