C20H18O6S2 — CID 122188493
S-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]sulfanyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enethioate (PubChem CID 122188493) has the molecular formula C20H18O6S2 and a molecular weight of 418.49 g/mol. Its IUPAC name is S-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]sulfanyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enethioate.
| Compound Name | S-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]sulfanyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enethioate |
|---|---|
| PubChem CID | 122188493 |
| Molecular Formula | C20H18O6S2 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | S-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]sulfanyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enethioate |
| SMILES | COc1cc(/C=C/C(=O)SSC(=O)/C=C/c2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C20H18O6S2/c1-25-17-11-13(3-7-15(17)21)5-9-19(23)27-28-20(24)10-6-14-4-8-16(22)18(12-14)26-2/h3-12,21-22H,1-2H3/b9-5+,10-6+ |
| InChIKey | KWJUSVLCZZDHLD-NXZHAISVSA-N |
| XLogP | 4.28 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|