C10H11O4PW — CID 58284204
phosphanyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate;tungsten (PubChem CID 58284204) has the molecular formula C10H11O4PW and a molecular weight of 410.01 g/mol. Its IUPAC name is phosphanyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate;tungsten.
| Compound Name | phosphanyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate;tungsten |
|---|---|
| PubChem CID | 58284204 |
| Molecular Formula | C10H11O4PW |
| Molecular Weight | 410.01 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | phosphanyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate;tungsten |
| SMILES | COc1cc(/C=C/C(=O)OP)ccc1O.[W] |
| InChI | InChI=1S/C10H11O4P.W/c1-13-9-6-7(2-4-8(9)11)3-5-10(12)14-15;/h2-6,11H,15H2,1H3;/b5-3+; |
| InChIKey | FYMMSHOFNQBIOP-WGCWOXMQSA-N |
| XLogP | 1.74 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.01 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|