C24H22O12 — CID 46202731
2,3-bis[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy]butanedioic acid (PubChem CID 46202731) has the molecular formula C24H22O12 and a molecular weight of 502.43 g/mol. Its IUPAC name is 2,3-bis[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy]butanedioic acid.
| Compound Name | 2,3-bis[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy]butanedioic acid |
|---|---|
| PubChem CID | 46202731 |
| Molecular Formula | C24H22O12 |
| Molecular Weight | 502.43 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | 2,3-bis[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy]butanedioic acid |
| SMILES | COc1cc(/C=C/C(=O)OC(C(=O)O)C(OC(=O)/C=C/c2ccc(O)c(OC)c2)C(=O)O)ccc1O |
| InChI | InChI=1S/C24H22O12/c1-33-17-11-13(3-7-15(17)25)5-9-19(27)35-21(23(29)30)22(24(31)32)36-20(28)10-6-14-4-8-16(26)18(12-14)34-2/h3-12,21-22,25-26H,1-2H3,(H,29,30)(H,31,32)/b9-5+,10-6+ |
| InChIKey | RDGCNIQOPPEZSP-NXZHAISVSA-N |
| XLogP | 1.83 |
| TPSA | 186.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|