C22H20O10 — CID 138532986
(2S,3R)-2,3-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]butanoic acid (PubChem CID 138532986) has the molecular formula C22H20O10 and a molecular weight of 444.39 g/mol. Its IUPAC name is (2S,3R)-2,3-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]butanoic acid.
| Compound Name | (2S,3R)-2,3-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]butanoic acid |
|---|---|
| PubChem CID | 138532986 |
| Molecular Formula | C22H20O10 |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | (2S,3R)-2,3-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]butanoic acid |
| SMILES | C[C@@H](OC(=O)/C=C/c1ccc(O)c(O)c1)[C@H](OC(=O)/C=C/c1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C22H20O10/c1-12(31-19(27)8-4-13-2-6-15(23)17(25)10-13)21(22(29)30)32-20(28)9-5-14-3-7-16(24)18(26)11-14/h2-12,21,23-26H,1H3,(H,29,30)/b8-4+,9-5+/t12-,21+/m1/s1 |
| InChIKey | ISUNQDCGPVUMLK-ISOZMGBCSA-N |
| XLogP | 2.16 |
| TPSA | 170.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|