C37H34O18 — CID 99649705
(2S,3S,4R,5R)-2,3,4-tris[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-5-(2-methylpropanoyloxy)hexanedioic acid (PubChem CID 99649705) has the molecular formula C37H34O18 and a molecular weight of 766.66 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2,3,4-tris[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-5-(2-methylpropanoyloxy)hexanedioic acid.
| Compound Name | (2S,3S,4R,5R)-2,3,4-tris[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-5-(2-methylpropanoyloxy)hexanedioic acid |
|---|---|
| PubChem CID | 99649705 |
| Molecular Formula | C37H34O18 |
| Molecular Weight | 766.66 g/mol |
| Exact Mass | 766.17 |
| IUPAC Name | (2S,3S,4R,5R)-2,3,4-tris[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-5-(2-methylpropanoyloxy)hexanedioic acid |
| SMILES | CC(C)C(=O)O[C@@H](C(=O)O)[C@H](OC(=O)/C=C/c1ccc(O)c(O)c1)[C@H](OC(=O)/C=C/c1ccc(O)c(O)c1)[C@H](OC(=O)/C=C/c1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C37H34O18/c1-18(2)37(51)55-34(36(49)50)32(53-29(45)13-7-20-4-10-23(39)26(42)16-20)31(52-28(44)12-6-19-3-9-22(38)25(41)15-19)33(35(47)48)54-30(46)14-8-21-5-11-24(40)27(43)17-21/h3-18,31-34,38-43H,1-2H3,(H,47,48)(H,49,50)/b12-6+,13-7+,14-8+/t31-,32+,33-,34+/m0/s1 |
| InChIKey | RIVNVLITMUKUQK-NPSNEHMISA-N |
| XLogP | 2.83 |
| TPSA | 301.18 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.66 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|